ChemNet > CAS > 69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
Nama produk |
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
Sinonim |
[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
MF |
C11H7N3O2S |
Berat Molekul |
245.2572 |
InChI |
InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
CAS NO |
69625-13-4 |
Struktur Molekul |
|
Kepadatan |
1.397g/cm3 |
Titik lebur |
147℃ |
Titik didih |
457.3°C at 760 mmHg |
Indeks bias |
1.641 |
Titik nyala |
230.3°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|